CAS 1735-17-7 appears in our catalog under these names: Cyclohexane-d12, 95%, Cyclohexane-d12 (Reagent grade), 99 atom % D, min 99% Chemical Purity, Cyclohexane-d{12}, 99.5%(Isotopic) , Cyclohexane-D12 99,5 atom % D, Cyclohexane-d12, for NMR, 99.5 atom % D. Offered by: Combi-blocks, CDN, Thermo Scientific (Alfa Aesar), Deutero, Thermo Scientific (Acros). Available pack sizes: 10g, 5x1g, 10each, 2each, 0,75ml, 5ml, 10ml, 25ML.
1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuteriocyclohexane (CAS 1735-17-7) is a chemical compound with the molecular formula C6H12 and a molecular weight of 96.23 g/mol. IUPAC name: 1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuteriocyclohexane. InChIKey: XDTMQSROBMDMFD-LBTWDOQPSA-N.
| Molecular formula | C6H12 |
|---|---|
| Molecular weight | 96.23 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4,5,5,6,6-dodecadeuteriocyclohexane |
| InChIKey | XDTMQSROBMDMFD-LBTWDOQPSA-N |
| SMILES | [2H]C1(C(C(C(C(C1([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)