Products 15210-37-4

CAS 15210-37-4 is the registry number for Methyl 2,2-diethoxycyclobutane-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2,2-diethoxycyclobutane-1-carboxylate (CAS 15210-37-4) is a chemical compound with the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. IUPAC name: methyl 2,2-diethoxycyclobutane-1-carboxylate. InChIKey: CFODKVZDJYYJRM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18O4
Molecular weight202.25 g/mol
IUPAC namemethyl 2,2-diethoxycyclobutane-1-carboxylate
InChIKeyCFODKVZDJYYJRM-UHFFFAOYSA-N
SMILESCCOC1(CCC1C(=O)OC)OCC

Computed by PubChem (NCBI)