CAS 152110-17-3 is the registry number for Teuclatriol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
(1S,3aR,4R,7S,8R,8aR)-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,4,8-triol (CAS 152110-17-3) is a chemical compound with the molecular formula C15H28O3 and a molecular weight of 256.38 g/mol. IUPAC name: (1S,3aR,4R,7S,8R,8aR)-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,4,8-triol. InChIKey: CXQOZINRAFPQEX-QFEQQRJNSA-N.
| Molecular formula | C15H28O3 |
|---|---|
| Molecular weight | 256.38 g/mol |
| IUPAC name | (1S,3aR,4R,7S,8R,8aR)-1,4-dimethyl-7-propan-2-yl-2,3,3a,5,6,7,8,8a-octahydroazulene-1,4,8-triol |
| InChIKey | CXQOZINRAFPQEX-QFEQQRJNSA-N |
| SMILES | CC(C)[C@@H]1CC[C@@]([C@@H]2CC[C@]([C@H]2[C@@H]1O)(C)O)(C)O |
Computed by PubChem (NCBI)