CAS 152141-83-8 is the registry number for 1-Bromo-1-deoxy-β-L-idopyranuronic Acid Methyl Ester Triacetate. Offered by: TRC. Available pack sizes: 50mg.
Methyl (2S,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate (CAS 152141-83-8) is a chemical compound with the molecular formula C13H17BrO9 and a molecular weight of 397.17 g/mol. IUPAC name: methyl (2S,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate. InChIKey: GWTNLHGTLIBHHZ-GCHJQGSQSA-N.
| Molecular formula | C13H17BrO9 |
|---|---|
| Molecular weight | 397.17 g/mol |
| IUPAC name | methyl (2S,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate |
| InChIKey | GWTNLHGTLIBHHZ-GCHJQGSQSA-N |
| SMILES | CC(=O)O[C@@H]1[C@H]([C@H](O[C@@H]([C@H]1OC(=O)C)Br)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)