CAS 6919-98-8 is the registry number for Methyl 1-bromo-1-deoxy-2,3,4-tri-O-acetyl-beta-D-glucuronate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
Methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate (CAS 6919-98-8) is a chemical compound with the molecular formula C13H17BrO9 and a molecular weight of 397.17 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate. InChIKey: GWTNLHGTLIBHHZ-HHHUOAJASA-N.
| Molecular formula | C13H17BrO9 |
|---|---|
| Molecular weight | 397.17 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-bromooxane-2-carboxylate |
| InChIKey | GWTNLHGTLIBHHZ-HHHUOAJASA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)Br)C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)