CAS 152153-28-1 is the registry number for 6-Chloro-2,7-dimethyl-4H-chromen-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-2,7-dimethylchromen-4-one (CAS 152153-28-1) is a chemical compound with the molecular formula C11H9ClO2 and a molecular weight of 208.64 g/mol. IUPAC name: 6-chloro-2,7-dimethylchromen-4-one. InChIKey: PJBUPFHCLOODAL-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO2 |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 6-chloro-2,7-dimethylchromen-4-one |
| InChIKey | PJBUPFHCLOODAL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Cl)C(=O)C=C(O2)C |
Computed by PubChem (NCBI)