Products 1899895-07-8
CAS 1899895-07-8 is the registry number for 5-Chloro-2-ethyl-4h-chromen-4-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-chloro-2-ethylchromen-4-one (CAS 1899895-07-8) is a chemical compound with the molecular formula C11H9ClO2 and a molecular weight of 208.64 g/mol. IUPAC name: 5-chloro-2-ethylchromen-4-one. InChIKey: LJXSERPVHANSOF-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO2 |
|---|---|
| Molecular weight | 208.64 g/mol |
| IUPAC name | 5-chloro-2-ethylchromen-4-one |
| InChIKey | LJXSERPVHANSOF-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=O)C2=C(O1)C=CC=C2Cl |
Computed by PubChem (NCBI)