Products 1522078-85-8

CAS 1522078-85-8 appears in our catalog under these names: 4–(2,6–difluorophenyl)tetrahydro–2H–pyran–4–carboxylic acid, 4-(2,6-difluorophenyl)oxane-4-carboxylic acid. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

4-(2,6-difluorophenyl)oxane-4-carboxylic acid (CAS 1522078-85-8) is a chemical compound with the molecular formula C12H12F2O3 and a molecular weight of 242.22 g/mol. IUPAC name: 4-(2,6-difluorophenyl)oxane-4-carboxylic acid. InChIKey: IXHLLBPIABLOBS-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12F2O3
Molecular weight242.22 g/mol
IUPAC name4-(2,6-difluorophenyl)oxane-4-carboxylic acid
InChIKeyIXHLLBPIABLOBS-UHFFFAOYSA-N
SMILESC1COCCC1(C2=C(C=CC=C2F)F)C(=O)O

Computed by PubChem (NCBI)