CAS 2105558-82-3 is the registry number for Ethyl 6,8-difluorochromane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 6,8-difluoro-3,4-dihydro-2H-chromene-3-carboxylate (CAS 2105558-82-3) is a chemical compound with the molecular formula C12H12F2O3 and a molecular weight of 242.22 g/mol. IUPAC name: ethyl 6,8-difluoro-3,4-dihydro-2H-chromene-3-carboxylate. InChIKey: CCRLSJQOQIOVMQ-UHFFFAOYSA-N.
| Molecular formula | C12H12F2O3 |
|---|---|
| Molecular weight | 242.22 g/mol |
| IUPAC name | ethyl 6,8-difluoro-3,4-dihydro-2H-chromene-3-carboxylate |
| InChIKey | CCRLSJQOQIOVMQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(C(=CC(=C2)F)F)OC1 |
Computed by PubChem (NCBI)