Products 1522240-51-2

CAS 1522240-51-2 is the registry number for Cyclohexanecarboxylic acid, 4-hydroxy-2,2-dimethyl-, methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 4-hydroxy-2,2-dimethylcyclohexane-1-carboxylate (CAS 1522240-51-2) is a chemical compound with the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. IUPAC name: methyl 4-hydroxy-2,2-dimethylcyclohexane-1-carboxylate. InChIKey: VJVIIWLPMNHABH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18O3
Molecular weight186.25 g/mol
IUPAC namemethyl 4-hydroxy-2,2-dimethylcyclohexane-1-carboxylate
InChIKeyVJVIIWLPMNHABH-UHFFFAOYSA-N
SMILESCC1(CC(CCC1C(=O)OC)O)C

Computed by PubChem (NCBI)