Products 1523068-91-8
CAS 1523068-91-8 appears in our catalog under these names: 6'-Methoxyspiro[cyclopropane-1,3'-indoline], 95%, 6'-Methoxyspiro(cyclopropane-1,3'-indoline), 98%, 6'–METHOXYSPIRO(CYCLOPROPANE–1，3'–INDOLINE). Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g.
6-methoxyspiro[1,2-dihydroindole-3,1'-cyclopropane] (CAS 1523068-91-8) is a chemical compound with the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. IUPAC name: 6-methoxyspiro[1,2-dihydroindole-3,1'-cyclopropane]. InChIKey: MQLGTQXAPZVWJU-UHFFFAOYSA-N.
| Molecular formula | C11H13NO |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 6-methoxyspiro[1,2-dihydroindole-3,1'-cyclopropane] |
| InChIKey | MQLGTQXAPZVWJU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C3(CC3)CN2 |
Computed by PubChem (NCBI)