Products 1523113-65-6
CAS 1523113-65-6 is the registry number for 3-Amino-n-ethyl-5-fluoro-n-methylbenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
3-amino-N-ethyl-5-fluoro-N-methylbenzamide (CAS 1523113-65-6) is a chemical compound with the molecular formula C10H13FN2O and a molecular weight of 196.22 g/mol. IUPAC name: 3-amino-N-ethyl-5-fluoro-N-methylbenzamide. InChIKey: VQPILRGSEXJEEM-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | 3-amino-N-ethyl-5-fluoro-N-methylbenzamide |
| InChIKey | VQPILRGSEXJEEM-UHFFFAOYSA-N |
| SMILES | CCN(C)C(=O)C1=CC(=CC(=C1)F)N |
Computed by PubChem (NCBI)