CAS 784155-54-0 is the registry number for N-(5-Fluoro-pyridin-2-yl)-2,2-dimethyl-propionamide, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
N-(5-fluoro-2-pyridinyl)-2,2-dimethylpropanamide (CAS 784155-54-0) is a chemical compound with the molecular formula C10H13FN2O and a molecular weight of 196.22 g/mol. IUPAC name: N-(5-fluoro-2-pyridinyl)-2,2-dimethylpropanamide. InChIKey: WIAYCNUDQFSZFQ-UHFFFAOYSA-N.
| Molecular formula | C10H13FN2O |
|---|---|
| Molecular weight | 196.22 g/mol |
| IUPAC name | N-(5-fluoro-2-pyridinyl)-2,2-dimethylpropanamide |
| InChIKey | WIAYCNUDQFSZFQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NC=C(C=C1)F |
Computed by PubChem (NCBI)