CAS 1523162-09-5 is the registry number for 2-Ethyl-6,8-difluoro-2H-benzo[b][1,4]oxazin-3(4H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-ethyl-6,8-difluoro-4H-1,4-benzoxazin-3-one (CAS 1523162-09-5) is a chemical compound with the molecular formula C10H9F2NO2 and a molecular weight of 213.18 g/mol. IUPAC name: 2-ethyl-6,8-difluoro-4H-1,4-benzoxazin-3-one. InChIKey: QHPZGWKHDJEPLP-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO2 |
|---|---|
| Molecular weight | 213.18 g/mol |
| IUPAC name | 2-ethyl-6,8-difluoro-4H-1,4-benzoxazin-3-one |
| InChIKey | QHPZGWKHDJEPLP-UHFFFAOYSA-N |
| SMILES | CCC1C(=O)NC2=C(O1)C(=CC(=C2)F)F |
Computed by PubChem (NCBI)