Products 2815225-67-1
CAS 2815225-67-1 is the registry number for 4-(Difluoromethyl)-6-(hydroxymethyl)isoindolin-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(difluoromethyl)-6-(hydroxymethyl)-2,3-dihydroisoindol-1-one (CAS 2815225-67-1) is a chemical compound with the molecular formula C10H9F2NO2 and a molecular weight of 213.18 g/mol. IUPAC name: 4-(difluoromethyl)-6-(hydroxymethyl)-2,3-dihydroisoindol-1-one. InChIKey: OUKWMWLCVYWECS-UHFFFAOYSA-N.
| Molecular formula | C10H9F2NO2 |
|---|---|
| Molecular weight | 213.18 g/mol |
| IUPAC name | 4-(difluoromethyl)-6-(hydroxymethyl)-2,3-dihydroisoindol-1-one |
| InChIKey | OUKWMWLCVYWECS-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2C(F)F)CO)C(=O)N1 |
Computed by PubChem (NCBI)