CAS 1523530-50-8 appears in our catalog under these names: exo-8-Azabicyclo(3.2.1)octane-3-carboxylic acid hydrochloride, 97%, Exo-8-azabicyclo(3.2.1)octane-3-carboxylic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 2,5g.
(1R,5S)-8-azabicyclo[3.2.1]octane-3-carboxylic acid;hydrochloride (CAS 1523530-50-8) is a chemical compound with the molecular formula C8H14ClNO2 and a molecular weight of 191.65 g/mol. IUPAC name: (1R,5S)-8-azabicyclo[3.2.1]octane-3-carboxylic acid;hydrochloride. InChIKey: MFAUMPVIUINZHM-FXFNDYDPSA-N.
| Molecular formula | C8H14ClNO2 |
|---|---|
| Molecular weight | 191.65 g/mol |
| IUPAC name | (1R,5S)-8-azabicyclo[3.2.1]octane-3-carboxylic acid;hydrochloride |
| InChIKey | MFAUMPVIUINZHM-FXFNDYDPSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2)C(=O)O.Cl |
Computed by PubChem (NCBI)