CAS 1523541-77-6 appears in our catalog under these names: (2R,4R)-2-Methylpiperidin-4-ol hydrochloride, 97%, (2R,4R)-2-Methylpiperidin-4-ol hydrochloride, 97%, 97%, (2R,4R)-2-Methylpiperidin-4-ol hydrochloride, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
(2R,4R)-2-methylpiperidin-4-ol;hydrochloride (CAS 1523541-77-6) is a chemical compound with the molecular formula C6H14ClNO and a molecular weight of 151.63 g/mol. IUPAC name: (2R,4R)-2-methylpiperidin-4-ol;hydrochloride. InChIKey: DXKHDUOLFKISDJ-KGZKBUQUSA-N.
| Molecular formula | C6H14ClNO |
|---|---|
| Molecular weight | 151.63 g/mol |
| IUPAC name | (2R,4R)-2-methylpiperidin-4-ol;hydrochloride |
| InChIKey | DXKHDUOLFKISDJ-KGZKBUQUSA-N |
| SMILES | C[C@@H]1C[C@@H](CCN1)O.Cl |
Computed by PubChem (NCBI)