CAS 1523571-22-3 is the registry number for 5-Cyclopropyl-1,3,4-oxadiazole-2-carboxylic acid lithium salt, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Lithium 5-cyclopropyl-1,3,4-oxadiazole-2-carboxylate (CAS 1523571-22-3) is a chemical compound with the molecular formula C6H5LiN2O3 and a molecular weight of 160.1 g/mol. IUPAC name: lithium 5-cyclopropyl-1,3,4-oxadiazole-2-carboxylate. InChIKey: JMHUBPLCZSUHQM-UHFFFAOYSA-M.
| Molecular formula | C6H5LiN2O3 |
|---|---|
| Molecular weight | 160.1 g/mol |
| IUPAC name | lithium 5-cyclopropyl-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | JMHUBPLCZSUHQM-UHFFFAOYSA-M |
| SMILES | [Li+].C1CC1C2=NN=C(O2)C(=O)[O-] |
Computed by PubChem (NCBI)