CAS 2755146-49-5 is the registry number for Lithium 4-cyclopropyl-1,2,5-oxadiazole-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Lithium 4-cyclopropyl-1,2,5-oxadiazole-3-carboxylate (CAS 2755146-49-5) is a chemical compound with the molecular formula C6H5LiN2O3 and a molecular weight of 160.1 g/mol. IUPAC name: lithium 4-cyclopropyl-1,2,5-oxadiazole-3-carboxylate. InChIKey: KMLLOVAPHXLSFB-UHFFFAOYSA-M.
| Molecular formula | C6H5LiN2O3 |
|---|---|
| Molecular weight | 160.1 g/mol |
| IUPAC name | lithium 4-cyclopropyl-1,2,5-oxadiazole-3-carboxylate |
| InChIKey | KMLLOVAPHXLSFB-UHFFFAOYSA-M |
| SMILES | [Li+].C1CC1C2=NON=C2C(=O)[O-] |
Computed by PubChem (NCBI)