CAS 1523571-92-7 appears in our catalog under these names: 4-Pyridazineacetic acid, sodium salt (1:1), 95%, 2-(Pyridazin-4-yl)acetic acid,sodium salt, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 10g, 1g, 5g.
Sodium 2-pyridazin-4-ylacetate (CAS 1523571-92-7) is a chemical compound with the molecular formula C6H5N2NaO2 and a molecular weight of 160.11 g/mol. IUPAC name: sodium 2-pyridazin-4-ylacetate. InChIKey: HUFSTXGKNYDRMS-UHFFFAOYSA-M.
| Molecular formula | C6H5N2NaO2 |
|---|---|
| Molecular weight | 160.11 g/mol |
| IUPAC name | sodium 2-pyridazin-4-ylacetate |
| InChIKey | HUFSTXGKNYDRMS-UHFFFAOYSA-M |
| SMILES | C1=CN=NC=C1CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)