CAS 1820648-87-0 is the registry number for Sodium 2-(pyrimidin-4-yl)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Sodium 2-pyrimidin-4-ylacetate (CAS 1820648-87-0) is a chemical compound with the molecular formula C6H5N2NaO2 and a molecular weight of 160.11 g/mol. IUPAC name: sodium 2-pyrimidin-4-ylacetate. InChIKey: IWLBJZZNYIMLLW-UHFFFAOYSA-M.
| Molecular formula | C6H5N2NaO2 |
|---|---|
| Molecular weight | 160.11 g/mol |
| IUPAC name | sodium 2-pyrimidin-4-ylacetate |
| InChIKey | IWLBJZZNYIMLLW-UHFFFAOYSA-M |
| SMILES | C1=CN=CN=C1CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)