Products 1523572-02-2

CAS 1523572-02-2 is the registry number for 2,2,2-Trifluoroacetic acid compound with 2-azaspiro(3.3)heptane-6-carboxylic acid (1:1), 97%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 10g.

Structural formula: {0} (CAS {1})

2-azaspiro[3.3]heptane-6-carboxylic acid;2,2,2-trifluoroacetic acid (CAS 1523572-02-2) is a chemical compound with the molecular formula C9H12F3NO4 and a molecular weight of 255.19 g/mol. IUPAC name: 2-azaspiro[3.3]heptane-6-carboxylic acid;2,2,2-trifluoroacetic acid. InChIKey: NNXOMHNQSWSFNN-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12F3NO4
Molecular weight255.19 g/mol
IUPAC name2-azaspiro[3.3]heptane-6-carboxylic acid;2,2,2-trifluoroacetic acid
InChIKeyNNXOMHNQSWSFNN-UHFFFAOYSA-N
SMILESC1C(CC12CNC2)C(=O)O.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)