CAS 1523572-02-2 is the registry number for 2,2,2-Trifluoroacetic acid compound with 2-azaspiro(3.3)heptane-6-carboxylic acid (1:1), 97%. Offered by: AmBeed. Available pack sizes: 5g, 100mg, 10g.
2-azaspiro[3.3]heptane-6-carboxylic acid;2,2,2-trifluoroacetic acid (CAS 1523572-02-2) is a chemical compound with the molecular formula C9H12F3NO4 and a molecular weight of 255.19 g/mol. IUPAC name: 2-azaspiro[3.3]heptane-6-carboxylic acid;2,2,2-trifluoroacetic acid. InChIKey: NNXOMHNQSWSFNN-UHFFFAOYSA-N.
| Molecular formula | C9H12F3NO4 |
|---|---|
| Molecular weight | 255.19 g/mol |
| IUPAC name | 2-azaspiro[3.3]heptane-6-carboxylic acid;2,2,2-trifluoroacetic acid |
| InChIKey | NNXOMHNQSWSFNN-UHFFFAOYSA-N |
| SMILES | C1C(CC12CNC2)C(=O)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)