CAS 2757999-78-1 is the registry number for 1-Azaspiro(3.3)heptane-6-carboxylic acid--2,2,2-trifluoroacetic acid (1/1), 98%. Offered by: AmBeed. Available pack sizes: 1g.
1-azaspiro[3.3]heptane-6-carboxylic acid;2,2,2-trifluoroacetic acid (CAS 2757999-78-1) is a chemical compound with the molecular formula C9H12F3NO4 and a molecular weight of 255.19 g/mol. IUPAC name: 1-azaspiro[3.3]heptane-6-carboxylic acid;2,2,2-trifluoroacetic acid. InChIKey: HNOVQUVOKDNAEW-UHFFFAOYSA-N.
| Molecular formula | C9H12F3NO4 |
|---|---|
| Molecular weight | 255.19 g/mol |
| IUPAC name | 1-azaspiro[3.3]heptane-6-carboxylic acid;2,2,2-trifluoroacetic acid |
| InChIKey | HNOVQUVOKDNAEW-UHFFFAOYSA-N |
| SMILES | C1CNC12CC(C2)C(=O)O.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)