Products 2757999-78-1

CAS 2757999-78-1 is the registry number for 1-Azaspiro(3.3)heptane-6-carboxylic acid--2,2,2-trifluoroacetic acid (1/1), 98%. Offered by: AmBeed. Available pack sizes: 1g.

1-azaspiro[3.3]heptane-6-carboxylic acid;2,2,2-trifluoroacetic acid (CAS 2757999-78-1) is a chemical compound with the molecular formula C9H12F3NO4 and a molecular weight of 255.19 g/mol. IUPAC name: 1-azaspiro[3.3]heptane-6-carboxylic acid;2,2,2-trifluoroacetic acid. InChIKey: HNOVQUVOKDNAEW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12F3NO4
Molecular weight255.19 g/mol
IUPAC name1-azaspiro[3.3]heptane-6-carboxylic acid;2,2,2-trifluoroacetic acid
InChIKeyHNOVQUVOKDNAEW-UHFFFAOYSA-N
SMILESC1CNC12CC(C2)C(=O)O.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)