CAS 152460-08-7 appears in our catalog under these names: 1-(2-Methyl-5-nitrophenyl)guanidine Nitrate, 1–(2–Methyl–5–nitrophenyl)guanidine Nitrate, 1-(2-Methyl-5-nitrophenyl)guanidine Nitrate, >97.0%(HPLC)(T), 1-(2-Methyl-5-nitrophenyl)guanidine nitrate 95%, 1-(2-Methyl-5-nitrophenyl)guanidine Nitrate, 95%+, 95%+. Offered by: Mikromol, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25mg, 100g, 250g, 25g, 1g, 5g, 500g.
2-(2-methyl-5-nitrophenyl)guanidine;nitric acid (CAS 152460-08-7) is a chemical compound with the molecular formula C8H11N5O5 and a molecular weight of 257.20 g/mol. IUPAC name: 2-(2-methyl-5-nitrophenyl)guanidine;nitric acid. InChIKey: IINMQQJNRFDBMV-UHFFFAOYSA-N.
| Molecular formula | C8H11N5O5 |
|---|---|
| Molecular weight | 257.20 g/mol |
| IUPAC name | 2-(2-methyl-5-nitrophenyl)guanidine;nitric acid |
| InChIKey | IINMQQJNRFDBMV-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])N=C(N)N.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)