CAS 796738-73-3 appears in our catalog under these names: 2-Methyl-4-nitrophenylguanidine Nitrate, >95% (HPLC), 2-Methyl-4-nitrophenylguanidine Nitrate. Offered by: TRC, Mikromol. Available pack sizes: 25mg, 50mg, 5mg.
2-(2-methyl-4-nitrophenyl)guanidine;nitric acid (CAS 796738-73-3) is a chemical compound with the molecular formula C8H11N5O5 and a molecular weight of 257.20 g/mol. IUPAC name: 2-(2-methyl-4-nitrophenyl)guanidine;nitric acid. InChIKey: NKZZMEREYKESSX-UHFFFAOYSA-N.
| Molecular formula | C8H11N5O5 |
|---|---|
| Molecular weight | 257.20 g/mol |
| IUPAC name | 2-(2-methyl-4-nitrophenyl)guanidine;nitric acid |
| InChIKey | NKZZMEREYKESSX-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])N=C(N)N.[N+](=O)(O)[O-] |
Computed by PubChem (NCBI)