Products 152481-80-6
CAS 152481-80-6 is the registry number for teuhetenone A. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
(4aS,8S)-8-hydroxy-4a,8-dimethyl-4,5,6,7-tetrahydro-3H-naphthalen-2-one (CAS 152481-80-6) is a chemical compound with the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. IUPAC name: (4aS,8S)-8-hydroxy-4a,8-dimethyl-4,5,6,7-tetrahydro-3H-naphthalen-2-one. InChIKey: NGTFVDVHOJMAJY-RYUDHWBXSA-N.
| Molecular formula | C12H18O2 |
|---|---|
| Molecular weight | 194.27 g/mol |
| IUPAC name | (4aS,8S)-8-hydroxy-4a,8-dimethyl-4,5,6,7-tetrahydro-3H-naphthalen-2-one |
| InChIKey | NGTFVDVHOJMAJY-RYUDHWBXSA-N |
| SMILES | C[C@@]12CCC[C@](C1=CC(=O)CC2)(C)O |
Computed by PubChem (NCBI)