CAS 152487-70-2 is the registry number for 3,4-Dimethylthieno[2,3-b]thiophene-2,5-dicarbonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarbonitrile (CAS 152487-70-2) is a chemical compound with the molecular formula C10H6N2S2 and a molecular weight of 218.3 g/mol. IUPAC name: 3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarbonitrile. InChIKey: QGVYSIYRSSYZHJ-UHFFFAOYSA-N.
| Molecular formula | C10H6N2S2 |
|---|---|
| Molecular weight | 218.3 g/mol |
| IUPAC name | 3,4-dimethylthieno[2,3-b]thiophene-2,5-dicarbonitrile |
| InChIKey | QGVYSIYRSSYZHJ-UHFFFAOYSA-N |
| SMILES | CC1=C(SC2=C1C(=C(S2)C#N)C)C#N |
Computed by PubChem (NCBI)