Products 831-20-9
CAS 831-20-9 is the registry number for [1,4]Dithiino[2,3-c:5,6-c′]dipyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,9-dithia-5,12-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene (CAS 831-20-9) is a chemical compound with the molecular formula C10H6N2S2 and a molecular weight of 218.3 g/mol. IUPAC name: 2,9-dithia-5,12-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene. InChIKey: HAFPXKZXUPYWPB-UHFFFAOYSA-N.
| Molecular formula | C10H6N2S2 |
|---|---|
| Molecular weight | 218.3 g/mol |
| IUPAC name | 2,9-dithia-5,12-diazatricyclo[8.4.0.03,8]tetradeca-1(10),3(8),4,6,11,13-hexaene |
| InChIKey | HAFPXKZXUPYWPB-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=C1SC3=C(S2)C=CN=C3 |
Computed by PubChem (NCBI)