CAS 15250-41-6 appears in our catalog under these names: Dexrazoxane Impurity 13, Dexrazoxane Impurity 8 95%, (S)-1,2-Diaminopropane-N,N,N',N'-tetraacetic acid, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 250mg, 1g, 5g.
2-[[(2S)-2-[bis(carboxymethyl)amino]propyl]-(carboxymethyl)amino]acetic acid (CAS 15250-41-6) is a chemical compound with the molecular formula C11H18N2O8 and a molecular weight of 306.27 g/mol. IUPAC name: 2-[[(2S)-2-[bis(carboxymethyl)amino]propyl]-(carboxymethyl)amino]acetic acid. InChIKey: XNCSCQSQSGDGES-ZETCQYMHSA-N.
| Molecular formula | C11H18N2O8 |
|---|---|
| Molecular weight | 306.27 g/mol |
| IUPAC name | 2-[[(2S)-2-[bis(carboxymethyl)amino]propyl]-(carboxymethyl)amino]acetic acid |
| InChIKey | XNCSCQSQSGDGES-ZETCQYMHSA-N |
| SMILES | C[C@@H](CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)