CAS 4408-81-5 appears in our catalog under these names: 1,2-Diaminopropane-n,n,n',n'-tetraacetic acid, 95%, 1,2-Diaminopropane-N,N,N',N'-tetraacetic Acid, 1,2–Diaminopropane–N,N,N',N'–tetraacetic Acid, 1,2-Diaminopropane-N,N,N',N'-tetraacetic Acid, >98.0%(T), 1,2-DIAMINOPROPANE-N,N,N',N'-TETRAACETIC. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, TCI. Available pack sizes: 25g, 1g, 100g, 5g, 10g, 100mg, 500g.
2-[2-[bis(carboxymethyl)amino]propyl-(carboxymethyl)amino]acetic acid (CAS 4408-81-5) is a chemical compound with the molecular formula C11H18N2O8 and a molecular weight of 306.27 g/mol. IUPAC name: 2-[2-[bis(carboxymethyl)amino]propyl-(carboxymethyl)amino]acetic acid. InChIKey: XNCSCQSQSGDGES-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O8 |
|---|---|
| Molecular weight | 306.27 g/mol |
| IUPAC name | 2-[2-[bis(carboxymethyl)amino]propyl-(carboxymethyl)amino]acetic acid |
| InChIKey | XNCSCQSQSGDGES-UHFFFAOYSA-N |
| SMILES | CC(CN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
Computed by PubChem (NCBI)