CAS 152503-91-8 is the registry number for AG-85. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-[(4-indol-1-ylsulfonyl-N-prop-2-ynylanilino)methyl]-2-methyl-3H-quinazolin-4-one (CAS 152503-91-8) is a chemical compound with the molecular formula C27H22N4O3S and a molecular weight of 482.6 g/mol. IUPAC name: 6-[(4-indol-1-ylsulfonyl-N-prop-2-ynylanilino)methyl]-2-methyl-3H-quinazolin-4-one. InChIKey: RZPDNDSSUGJDEO-UHFFFAOYSA-N.
| Molecular formula | C27H22N4O3S |
|---|---|
| Molecular weight | 482.6 g/mol |
| IUPAC name | 6-[(4-indol-1-ylsulfonyl-N-prop-2-ynylanilino)methyl]-2-methyl-3H-quinazolin-4-one |
| InChIKey | RZPDNDSSUGJDEO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C=C2)CN(CC#C)C3=CC=C(C=C3)S(=O)(=O)N4C=CC5=CC=CC=C54)C(=O)N1 |
Computed by PubChem (NCBI)