CAS 364762-86-7 appears in our catalog under these names: TD-198946 (1-methyl-8-(4-(2-quinolinylmethoxy)phenoxy)-4,5-dihydro-1h-thieno (3,4-g)indazole-6-carboxamide), TD–198946, TD-198946/ 100%, TD-198946, TD-198946 98%. Offered by: Chemat Brand, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: on request, 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 2mg, 25mg, 50mg.
1-methyl-8-[4-(quinolin-2-ylmethoxy)phenoxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxamide (CAS 364762-86-7) is a chemical compound with the molecular formula C27H22N4O3S and a molecular weight of 482.6 g/mol. IUPAC name: 1-methyl-8-[4-(quinolin-2-ylmethoxy)phenoxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxamide. InChIKey: QGAMAWMLTUNPAB-UHFFFAOYSA-N.
| Molecular formula | C27H22N4O3S |
|---|---|
| Molecular weight | 482.6 g/mol |
| IUPAC name | 1-methyl-8-[4-(quinolin-2-ylmethoxy)phenoxy]-4,5-dihydrothieno[3,4-g]indazole-6-carboxamide |
| InChIKey | QGAMAWMLTUNPAB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(CCC3=C(SC(=C32)OC4=CC=C(C=C4)OCC5=NC6=CC=CC=C6C=C5)C(=O)N)C=N1 |
Computed by PubChem (NCBI)