CAS 15251-22-6 is the registry number for Ethylenediaminetetraacetic acid-d4. Offered by: Chemat Brand. Available pack sizes: on request.
Deuterio 2-[2-[bis(2-deuteriooxy-2-oxoethyl)amino]ethyl-(2-deuteriooxy-2-oxoethyl)amino]acetate (CAS 15251-22-6) is a chemical compound with the molecular formula C10H16N2O8 and a molecular weight of 296.27 g/mol. IUPAC name: deuterio 2-[2-[bis(2-deuteriooxy-2-oxoethyl)amino]ethyl-(2-deuteriooxy-2-oxoethyl)amino]acetate. InChIKey: KCXVZYZYPLLWCC-JBISRTOLSA-N.
| Molecular formula | C10H16N2O8 |
|---|---|
| Molecular weight | 296.27 g/mol |
| IUPAC name | deuterio 2-[2-[bis(2-deuteriooxy-2-oxoethyl)amino]ethyl-(2-deuteriooxy-2-oxoethyl)amino]acetate |
| InChIKey | KCXVZYZYPLLWCC-JBISRTOLSA-N |
| SMILES | [2H]OC(=O)CN(CCN(CC(=O)O[2H])CC(=O)O[2H])CC(=O)O[2H] |
Computed by PubChem (NCBI)