Products 1215408-17-5
CAS 1215408-17-5 appears in our catalog under these names: 2,2',2'',2'''-(Ethane-1,2-diylbis(azanetriyl))tetraacetic-1-13C acid, 95%, Ethylenediamine-N,N,N’,N’-tetraacetic Acid-13C4, >95% (HPLC), Ethylenediaminetetraacetic acid-13C4. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 10 mg, 1 mg.
2-[2-[bis(hydroxycarbonylmethyl)amino]ethyl-(hydroxycarbonylmethyl)amino]acetic acid (CAS 1215408-17-5) is a chemical compound with the molecular formula C10H16N2O8 and a molecular weight of 296.21 g/mol. IUPAC name: 2-[2-[bis(hydroxycarbonylmethyl)amino]ethyl-(hydroxycarbonylmethyl)amino]acetic acid. InChIKey: KCXVZYZYPLLWCC-HZKSPUCSSA-N.
| Molecular formula | C10H16N2O8 |
|---|---|
| Molecular weight | 296.21 g/mol |
| IUPAC name | 2-[2-[bis(hydroxycarbonylmethyl)amino]ethyl-(hydroxycarbonylmethyl)amino]acetic acid |
| InChIKey | KCXVZYZYPLLWCC-HZKSPUCSSA-N |
| SMILES | C(CN(C[13C](=O)O)C[13C](=O)O)N(C[13C](=O)O)C[13C](=O)O |
Computed by PubChem (NCBI)