CAS 15254-25-8 appears in our catalog under these names: 2,3,6,7-Tetramethyl Anthracene, 2,3,6,7-Tetramethylanthracene 96%, 2,3,6,7-Tetramethylanthracene, 96%, 96%. Offered by: TRC, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
2,3,6,7-tetramethylanthracene (CAS 15254-25-8) is a chemical compound with the molecular formula C18H18 and a molecular weight of 234.3 g/mol. IUPAC name: 2,3,6,7-tetramethylanthracene. InChIKey: JGJWRGCEYNJFQJ-UHFFFAOYSA-N.
| Molecular formula | C18H18 |
|---|---|
| Molecular weight | 234.3 g/mol |
| IUPAC name | 2,3,6,7-tetramethylanthracene |
| InChIKey | JGJWRGCEYNJFQJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=CC3=C(C=C(C(=C3)C)C)C=C2C=C1C |
Computed by PubChem (NCBI)