CAS 2961-02-6 is the registry number for 9,10-Dimethyl-9,10-dihydro-9,10-ethanoanthracene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,8-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene (CAS 2961-02-6) is a chemical compound with the molecular formula C18H18 and a molecular weight of 234.3 g/mol. IUPAC name: 1,8-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene. InChIKey: RDHANTKFSHTKBB-UHFFFAOYSA-N.
| Molecular formula | C18H18 |
|---|---|
| Molecular weight | 234.3 g/mol |
| IUPAC name | 1,8-dimethyltetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaene |
| InChIKey | RDHANTKFSHTKBB-UHFFFAOYSA-N |
| SMILES | CC12CCC(C3=CC=CC=C31)(C4=CC=CC=C24)C |
Computed by PubChem (NCBI)