CAS 152623-94-4 appears in our catalog under these names: 2,3-Dihydro-alpha-methyl-5-benzofuranethanamine Hydrochloride, 5-APDB HCl (1-(2,3-Dihydro-1-benzofuran-5-yl)-propan-2-amine Hydrochloride, 5-(2-Aminopropyl)-2,3-dihydrobenzofuran Hydrochloride, 3-Desoxy-MDA HCl), 5–APDB (hydrochloride), 5-Apdb (hydrochloride). Offered by: TRC, LoGiCal, GLPBio, Biosynth. Available pack sizes: 100mg, 10mg, 1mg, 5mg, 25mg, 50mg.
1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-amine;hydrochloride (CAS 152623-94-4) is a chemical compound with the molecular formula C11H16ClNO and a molecular weight of 213.70 g/mol. IUPAC name: 1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-amine;hydrochloride. InChIKey: BZKLFXQUBIRXAK-UHFFFAOYSA-N.
| Molecular formula | C11H16ClNO |
|---|---|
| Molecular weight | 213.70 g/mol |
| IUPAC name | 1-(2,3-dihydro-1-benzofuran-5-yl)propan-2-amine;hydrochloride |
| InChIKey | BZKLFXQUBIRXAK-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC2=C(C=C1)OCC2)N.Cl |
Computed by PubChem (NCBI)