CAS 152636-45-8 appears in our catalog under these names: 4'–(Di–p–tolylamino)–(1,1'–biphenyl)–4–yl acrylate, 4'-(Di-p-tolylamino)-[1,1'-biphenyl]-4-yl Acrylate, >97.0%(HPLC)(N), 4'-(Di-p-tolylamino)-[1,1'-biphenyl]-4-yl Acrylate, 97.0%, 97.0%, 4'-(di-p-tolylaMino)-[1,1'-biphenyl]-4-yl acrylate, ≥97%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
[4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl] prop-2-enoate (CAS 152636-45-8) is a chemical compound with the molecular formula C29H25NO2 and a molecular weight of 419.5 g/mol. IUPAC name: [4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl] prop-2-enoate. InChIKey: IEQVLJZUACQOCO-UHFFFAOYSA-N.
| Molecular formula | C29H25NO2 |
|---|---|
| Molecular weight | 419.5 g/mol |
| IUPAC name | [4-[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]phenyl] prop-2-enoate |
| InChIKey | IEQVLJZUACQOCO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N(C2=CC=C(C=C2)C)C3=CC=C(C=C3)C4=CC=C(C=C4)OC(=O)C=C |
Computed by PubChem (NCBI)