Products 67413-25-6
CAS 67413-25-6 is the registry number for benzyl (S)-1-tritylaziridine-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (2S)-1-tritylaziridine-2-carboxylate (CAS 67413-25-6) is a chemical compound with the molecular formula C29H25NO2 and a molecular weight of 419.5 g/mol. IUPAC name: benzyl (2S)-1-tritylaziridine-2-carboxylate. InChIKey: QGOFOWMHAYEUGY-CEBUJLNPSA-N.
| Molecular formula | C29H25NO2 |
|---|---|
| Molecular weight | 419.5 g/mol |
| IUPAC name | benzyl (2S)-1-tritylaziridine-2-carboxylate |
| InChIKey | QGOFOWMHAYEUGY-CEBUJLNPSA-N |
| SMILES | C1[C@H](N1C(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4)C(=O)OCC5=CC=CC=C5 |
Computed by PubChem (NCBI)