CAS 1527503-11-2 appears in our catalog under these names: A-366, A-366/ 98.53% (existing batch purity), A 366, A-366, 95%, A-366 98%. Offered by: TRC, TargetMol, GLPBio, Thermo Scientific (Acros), Ambeed. Available pack sizes: 500mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
5'-methoxy-6'-(3-pyrrolidin-1-ylpropoxy)spiro[cyclobutane-1,3'-indole]-2'-amine (CAS 1527503-11-2) is a chemical compound with the molecular formula C19H27N3O2 and a molecular weight of 329.4 g/mol. IUPAC name: 5'-methoxy-6'-(3-pyrrolidin-1-ylpropoxy)spiro[cyclobutane-1,3'-indole]-2'-amine. InChIKey: BKCDJTRMYWSXMC-UHFFFAOYSA-N.
| Molecular formula | C19H27N3O2 |
|---|---|
| Molecular weight | 329.4 g/mol |
| IUPAC name | 5'-methoxy-6'-(3-pyrrolidin-1-ylpropoxy)spiro[cyclobutane-1,3'-indole]-2'-amine |
| InChIKey | BKCDJTRMYWSXMC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C3(CCC3)C(=N2)N)OCCCN4CCCC4 |
Computed by PubChem (NCBI)