Products 2270913-48-7

CAS 2270913-48-7 is the registry number for 4-(7-Amino-indol-1-ylmethyl)-piperidine-1-carboxylic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Tert-butyl 4-[(7-aminoindol-1-yl)methyl]piperidine-1-carboxylate (CAS 2270913-48-7) is a chemical compound with the molecular formula C19H27N3O2 and a molecular weight of 329.4 g/mol. IUPAC name: tert-butyl 4-[(7-aminoindol-1-yl)methyl]piperidine-1-carboxylate. InChIKey: DPFWCYURCGSRGV-UHFFFAOYSA-N.

Identity
Molecular formulaC19H27N3O2
Molecular weight329.4 g/mol
IUPAC nametert-butyl 4-[(7-aminoindol-1-yl)methyl]piperidine-1-carboxylate
InChIKeyDPFWCYURCGSRGV-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(CC1)CN2C=CC3=C2C(=CC=C3)N

Computed by PubChem (NCBI)