Products 1527946-98-0
CAS 1527946-98-0 is the registry number for Ethyl 5-amino-1-(3,5-difluorophenyl)-1h-pyrazole-4-carboxylate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
Ethyl 5-amino-1-(3,5-difluorophenyl)pyrazole-4-carboxylate (CAS 1527946-98-0) is a chemical compound with the molecular formula C12H11F2N3O2 and a molecular weight of 267.23 g/mol. IUPAC name: ethyl 5-amino-1-(3,5-difluorophenyl)pyrazole-4-carboxylate. InChIKey: DBUPNKAKTQONOB-UHFFFAOYSA-N.
| Molecular formula | C12H11F2N3O2 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | ethyl 5-amino-1-(3,5-difluorophenyl)pyrazole-4-carboxylate |
| InChIKey | DBUPNKAKTQONOB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(N=C1)C2=CC(=CC(=C2)F)F)N |
Computed by PubChem (NCBI)