CAS 351368-44-0 is the registry number for 2,4(1H,3H)-quinazolinedione, 3-amino-1-cyclopropyl-6,7-difluoro-8-methyl-, 98%. Offered by: AmBeed. Available pack sizes: 1g.
3-amino-1-cyclopropyl-6,7-difluoro-8-methylquinazoline-2,4-dione (CAS 351368-44-0) is a chemical compound with the molecular formula C12H11F2N3O2 and a molecular weight of 267.23 g/mol. IUPAC name: 3-amino-1-cyclopropyl-6,7-difluoro-8-methylquinazoline-2,4-dione. InChIKey: LFIVFMAMROTIED-UHFFFAOYSA-N.
| Molecular formula | C12H11F2N3O2 |
|---|---|
| Molecular weight | 267.23 g/mol |
| IUPAC name | 3-amino-1-cyclopropyl-6,7-difluoro-8-methylquinazoline-2,4-dione |
| InChIKey | LFIVFMAMROTIED-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC(=C1F)F)C(=O)N(C(=O)N2C3CC3)N |
Computed by PubChem (NCBI)