CAS 1528-53-6 appears in our catalog under these names: 1,2,4-Benzenetricarboxylic acid tripropyl ester, 95%, Tripropyl Trimellitate, Triisopropyl Benzene-1,2,4-Tricarboxylate, 97%, 97%, TRIPROPYL BENZENE-1,2,4-TRICARBOXYLATE, 99%(GC-MS),RG. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 10g, 100g.
Tripropyl benzene-1,2,4-tricarboxylate (CAS 1528-53-6) is a chemical compound with the molecular formula C18H24O6 and a molecular weight of 336.4 g/mol. IUPAC name: tripropyl benzene-1,2,4-tricarboxylate. InChIKey: QEUYMNVHNSOBRS-UHFFFAOYSA-N.
| Molecular formula | C18H24O6 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | tripropyl benzene-1,2,4-tricarboxylate |
| InChIKey | QEUYMNVHNSOBRS-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C1=CC(=C(C=C1)C(=O)OCCC)C(=O)OCCC |
Computed by PubChem (NCBI)