Products 1974-32-9

CAS 1974-32-9 is the registry number for 1,3,5-Tris(acetoxymethyl)-2,4,6-trimethylbenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

[3,5-bis(acetyloxymethyl)-2,4,6-trimethylphenyl]methyl acetate (CAS 1974-32-9) is a chemical compound with the molecular formula C18H24O6 and a molecular weight of 336.4 g/mol. IUPAC name: [3,5-bis(acetyloxymethyl)-2,4,6-trimethylphenyl]methyl acetate. InChIKey: PRTQVKYORBFUIC-UHFFFAOYSA-N.

Identity
Molecular formulaC18H24O6
Molecular weight336.4 g/mol
IUPAC name[3,5-bis(acetyloxymethyl)-2,4,6-trimethylphenyl]methyl acetate
InChIKeyPRTQVKYORBFUIC-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C(=C1COC(=O)C)C)COC(=O)C)C)COC(=O)C

Computed by PubChem (NCBI)