CAS 152812-49-2 appears in our catalog under these names: Thiazolo[3,2-a]indole-9-carboxylic acid, 95%, Thiazolo(3,2-a)indole-9-carboxylic acid, 95%, Thiazolo(3,2–a)indole–9–carboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
[1,3]thiazolo[3,2-a]indole-4-carboxylic acid (CAS 152812-49-2) is a chemical compound with the molecular formula C11H7NO2S and a molecular weight of 217.25 g/mol. IUPAC name: [1,3]thiazolo[3,2-a]indole-4-carboxylic acid. InChIKey: KBSNNUAQCDKOLL-UHFFFAOYSA-N.
| Molecular formula | C11H7NO2S |
|---|---|
| Molecular weight | 217.25 g/mol |
| IUPAC name | [1,3]thiazolo[3,2-a]indole-4-carboxylic acid |
| InChIKey | KBSNNUAQCDKOLL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C3N2C=CS3)C(=O)O |
Computed by PubChem (NCBI)