CAS 74802-03-2 is the registry number for 7-Isothiocyanato-4-methyl-2h-chromen-2-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
7-isothiocyanato-4-methylchromen-2-one (CAS 74802-03-2) is a chemical compound with the molecular formula C11H7NO2S and a molecular weight of 217.25 g/mol. IUPAC name: 7-isothiocyanato-4-methylchromen-2-one. InChIKey: RZODWTHSAMFLEZ-UHFFFAOYSA-N.
| Molecular formula | C11H7NO2S |
|---|---|
| Molecular weight | 217.25 g/mol |
| IUPAC name | 7-isothiocyanato-4-methylchromen-2-one |
| InChIKey | RZODWTHSAMFLEZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)N=C=S |
Computed by PubChem (NCBI)