CAS 152814-23-8 appears in our catalog under these names: 5-Aminoisoquinoline, HCl, 98%, 98%, Isoquinolin-5-amine hydrochloride, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Isoquinolin-5-amine;hydrochloride (CAS 152814-23-8) is a chemical compound with the molecular formula C9H9ClN2 and a molecular weight of 180.63 g/mol. IUPAC name: isoquinolin-5-amine;hydrochloride. InChIKey: KTTWAKYMVKDTRK-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2 |
|---|---|
| Molecular weight | 180.63 g/mol |
| IUPAC name | isoquinolin-5-amine;hydrochloride |
| InChIKey | KTTWAKYMVKDTRK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2)C(=C1)N.Cl |
Computed by PubChem (NCBI)