CAS 15284-15-8 appears in our catalog under these names: (S)-Methadone Hydrochloride (1.0mg/ml in Methanol), (S)-Methadone Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 1x1ml, 100mg, 10mg, 5mg.
(6S)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride (CAS 15284-15-8) is a chemical compound with the molecular formula C21H28ClNO and a molecular weight of 345.9 g/mol. IUPAC name: (6S)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride. InChIKey: FJQXCDYVZAHXNS-LMOVPXPDSA-N.
| Molecular formula | C21H28ClNO |
|---|---|
| Molecular weight | 345.9 g/mol |
| IUPAC name | (6S)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride |
| InChIKey | FJQXCDYVZAHXNS-LMOVPXPDSA-N |
| SMILES | CCC(=O)C(C[C@H](C)N(C)C)(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)