CAS 5967-73-7 is the registry number for (R)-Methadone Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
(6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride (CAS 5967-73-7) is a chemical compound with the molecular formula C21H28ClNO and a molecular weight of 345.9 g/mol. IUPAC name: (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride. InChIKey: FJQXCDYVZAHXNS-UNTBIKODSA-N.
| Molecular formula | C21H28ClNO |
|---|---|
| Molecular weight | 345.9 g/mol |
| IUPAC name | (6R)-6-(dimethylamino)-4,4-diphenylheptan-3-one;hydrochloride |
| InChIKey | FJQXCDYVZAHXNS-UNTBIKODSA-N |
| SMILES | CCC(=O)C(C[C@@H](C)N(C)C)(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)